ChemNet > CAS > 21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
| product Name |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride |
| CAS No |
21815-91-8 |
| Synonyms |
3-Chlorobenzo[b]thiophene-2-carbonyl chloride; AKOS B000002; AKOS AU36-M326; AKOS 92491; 3-CHLOROBENZOTHIOPHENE-2-CARBONYL CHLORIDE; BUTTPARK 30\06-08; ASISCHEM T31091; ART-CHEM-BB B000002; 3-chloro-1-benzothiophene-2-carbonyl chloride |
| Molecular Formula |
C9H4Cl2OS |
| Molecular Weight |
231.0985 |
| InChI |
InChI=1/C9H4Cl2OS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H |
| Molecular Structure |
![21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride](https://images-a.chemnet.com/suppliers/chembase/163/163543_1.gif)
|
| Density |
1.526g/cm3 |
| Melting point |
114℃ |
| Boiling point |
342.2°C at 760 mmHg |
| Refractive index |
1.686 |
| Flash point |
160.7°C |
| Vapour Pressur |
7.67E-05mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
